C9H12N2O4 — CID 139076968
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide;hydrate (PubChem CID 139076968) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide;hydrate.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide;hydrate |
|---|---|
| PubChem CID | 139076968 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]acetamide;hydrate |
| SMILES | CC(=O)N/N=C/c1ccc(O)c(O)c1.O |
| InChI | InChI=1S/C9H10N2O3.H2O/c1-6(12)11-10-5-7-2-3-8(13)9(14)4-7;/h2-5,13-14H,1H3,(H,11,12);1H2/b10-5+; |
| InChIKey | BJBGXJCREPCHBT-OAZHBLANSA-N |
| XLogP | -0.26 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|