C9H11N3O — CID 123694049
N-[(4-aminophenyl)methylideneamino]acetamide (PubChem CID 123694049) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is N-[(4-aminophenyl)methylideneamino]acetamide.
| Compound Name | N-[(4-aminophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 123694049 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-[(4-aminophenyl)methylideneamino]acetamide |
| SMILES | CC(=O)NN=Cc1ccc(N)cc1 |
| InChI | InChI=1S/C9H11N3O/c1-7(13)12-11-6-8-2-4-9(10)5-3-8/h2-6H,10H2,1H3,(H,12,13) |
| InChIKey | GIVITRIENGAISO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|