C15H17N3O — CID 123733247
N-[(4-aminophenyl)methylideneamino]-2-prop-1-enylpenta-2,4-dienamide (PubChem CID 123733247) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[(4-aminophenyl)methylideneamino]-2-prop-1-enylpenta-2,4-dienamide.
| Compound Name | N-[(4-aminophenyl)methylideneamino]-2-prop-1-enylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 123733247 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(4-aminophenyl)methylideneamino]-2-prop-1-enylpenta-2,4-dienamide |
| SMILES | C=CC=C(C=CC)C(=O)NN=Cc1ccc(N)cc1 |
| InChI | InChI=1S/C15H17N3O/c1-3-5-13(6-4-2)15(19)18-17-11-12-7-9-14(16)10-8-12/h3-11H,1,16H2,2H3,(H,18,19) |
| InChIKey | SBCMMVUVOAWXLD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|