C9H12N4O2 — CID 166950262
1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-methylguanidine (PubChem CID 166950262) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-methylguanidine.
| Compound Name | 1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-methylguanidine |
|---|---|
| PubChem CID | 166950262 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-methylguanidine |
| SMILES | C/N=C(\N)N/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H12N4O2/c1-11-9(10)13-12-5-6-2-3-7(14)8(15)4-6/h2-5,14-15H,1H3,(H3,10,11,13)/b12-5+ |
| InChIKey | MQSPLDPQRGJPHZ-LFYBBSHMSA-N |
| XLogP | -0.03 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|