C8H10N2O2 — CID 136786728
4-[(E)-(methylhydrazinylidene)methyl]benzene-1,2-diol (PubChem CID 136786728) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-[(E)-(methylhydrazinylidene)methyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-(methylhydrazinylidene)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136786728 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 4-[(E)-(methylhydrazinylidene)methyl]benzene-1,2-diol |
| SMILES | CN/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H10N2O2/c1-9-10-5-6-2-3-7(11)8(12)4-6/h2-5,9,11-12H,1H3/b10-5+ |
| InChIKey | CYEBMANKJZRWOS-BJMVGYQFSA-N |
| XLogP | 0.65 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|