C10H15N2O2+ — CID 135485458
[(Z)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium (PubChem CID 135485458) has the molecular formula C10H15N2O2+ and a molecular weight of 195.24 g/mol. Its IUPAC name is [(Z)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium.
| Compound Name | [(Z)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium |
|---|---|
| PubChem CID | 135485458 |
| Molecular Formula | C10H15N2O2+ |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [(Z)-(3,4-dihydroxyphenyl)methylideneamino]-trimethylazanium |
| SMILES | C[N+](C)(C)/N=C\c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H14N2O2/c1-12(2,3)11-7-8-4-5-9(13)10(14)6-8/h4-7H,1-3H3,(H-,11,13,14)/p+1 |
| InChIKey | DDIPCSIALILULA-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|