C8H12ClN5O2 — CID 162326957
2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 162326957) has the molecular formula C8H12ClN5O2 and a molecular weight of 245.67 g/mol. Its IUPAC name is 2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 162326957 |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-amino-1-[(3,4-dihydroxyphenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NN=C(N)NN=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H11N5O2.ClH/c9-8(12-10)13-11-4-5-1-2-6(14)7(15)3-5;/h1-4,14-15H,10H2,(H3,9,12,13);1H |
| InChIKey | RXOKWBKEAPJOGD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|