C9H13N5S — CID 74041348
2-amino-1-[(4-methylsulfanylphenyl)methylideneamino]guanidine (PubChem CID 74041348) has the molecular formula C9H13N5S and a molecular weight of 223.31 g/mol. Its IUPAC name is 2-amino-1-[(4-methylsulfanylphenyl)methylideneamino]guanidine.
| Compound Name | 2-amino-1-[(4-methylsulfanylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 74041348 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-amino-1-[(4-methylsulfanylphenyl)methylideneamino]guanidine |
| SMILES | CSc1ccc(C=NNC(N)=NN)cc1 |
| InChI | InChI=1S/C9H13N5S/c1-15-8-4-2-7(3-5-8)6-12-14-9(10)13-11/h2-6H,11H2,1H3,(H3,10,13,14) |
| InChIKey | DWEZWTCIWCUKLO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|