C15H13IN2O4 — CID 135614205
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(4-iodophenoxy)acetamide (PubChem CID 135614205) has the molecular formula C15H13IN2O4 and a molecular weight of 412.18 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(4-iodophenoxy)acetamide.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(4-iodophenoxy)acetamide |
|---|---|
| PubChem CID | 135614205 |
| Molecular Formula | C15H13IN2O4 |
| Molecular Weight | 412.18 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(4-iodophenoxy)acetamide |
| SMILES | O=C(COc1ccc(I)cc1)N/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H13IN2O4/c16-11-2-4-12(5-3-11)22-9-15(21)18-17-8-10-1-6-13(19)14(20)7-10/h1-8,19-20H,9H2,(H,18,21)/b17-8+ |
| InChIKey | CHKGDTQLAYXYRF-CAOOACKPSA-N |
| XLogP | 2.23 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|