C15H11Br2ClN2O3 — CID 137171959
2-(4-chlorophenyl)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 137171959) has the molecular formula C15H11Br2ClN2O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 137171959 |
| Molecular Formula | C15H11Br2ClN2O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 459.88 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)N/N=C\c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C15H11Br2ClN2O3/c16-11-6-9(14(22)13(17)15(11)23)7-19-20-12(21)5-8-1-3-10(18)4-2-8/h1-4,6-7,22-23H,5H2,(H,20,21)/b19-7- |
| InChIKey | JWQMVJLHTKQIEC-GXHLCREISA-N |
| XLogP | 3.97 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|