C16H11Br2ClN6O3S — CID 136863204
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 136863204) has the molecular formula C16H11Br2ClN6O3S and a molecular weight of 562.63 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 136863204 |
| Molecular Formula | C16H11Br2ClN6O3S |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 559.87 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)N/N=C\c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C16H11Br2ClN6O3S/c17-11-5-8(14(27)13(18)15(11)28)6-20-21-12(26)7-29-16-22-23-24-25(16)10-3-1-9(19)2-4-10/h1-6,27-28H,7H2,(H,21,26)/b20-6- |
| InChIKey | YCLKKAKJLFESBO-IOXNKQMXSA-N |
| XLogP | 3.49 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|