C17H14Cl2N6O2S — CID 998134
N-[(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 998134) has the molecular formula C17H14Cl2N6O2S and a molecular weight of 437.31 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 998134 |
| Molecular Formula | C17H14Cl2N6O2S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | N-[(3,5-dichloro-2-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=NNC(=O)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N6O2S/c1-27-16-11(7-12(18)8-14(16)19)9-20-21-15(26)10-28-17-22-23-24-25(17)13-5-3-2-4-6-13/h2-9H,10H2,1H3,(H,21,26) |
| InChIKey | MMYGABPLUHAKQU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|