C17H16N6O3S — CID 3907728
N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 3907728) has the molecular formula C17H16N6O3S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3907728 |
| Molecular Formula | C17H16N6O3S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2nnnn2-c2ccccc2)ccc1O |
| InChI | InChI=1S/C17H16N6O3S/c1-26-15-9-12(7-8-14(15)24)10-18-19-16(25)11-27-17-20-21-22-23(17)13-5-3-2-4-6-13/h2-10,24H,11H2,1H3,(H,19,25) |
| InChIKey | GIRCKKFFLKDGIN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|