C20H16N6O2S — CID 136663443
N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 136663443) has the molecular formula C20H16N6O2S and a molecular weight of 404.46 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 136663443 |
| Molecular Formula | C20H16N6O2S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)N/N=C\c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H16N6O2S/c27-18-11-10-14-6-4-5-9-16(14)17(18)12-21-22-19(28)13-29-20-23-24-25-26(20)15-7-2-1-3-8-15/h1-12,27H,13H2,(H,22,28)/b21-12- |
| InChIKey | JLOUOONKXDBKET-MTJSOVHGSA-N |
| XLogP | 2.76 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|