C16H12Cl2N6O2S — CID 135435561
N-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 135435561) has the molecular formula C16H12Cl2N6O2S and a molecular weight of 423.29 g/mol. Its IUPAC name is N-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 135435561 |
| Molecular Formula | C16H12Cl2N6O2S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | N-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)N/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H12Cl2N6O2S/c17-11-1-4-13(5-2-11)24-16(21-22-23-24)27-9-15(26)20-19-8-10-7-12(18)3-6-14(10)25/h1-8,25H,9H2,(H,20,26)/b19-8+ |
| InChIKey | MMQDVFXPOJFRDC-UFWORHAWSA-N |
| XLogP | 2.92 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|