C19H19ClN6O4S — CID 5431850
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 5431850) has the molecular formula C19H19ClN6O4S and a molecular weight of 462.92 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5431850 |
| Molecular Formula | C19H19ClN6O4S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CSc2nnnn2-c2ccc(Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C19H19ClN6O4S/c1-28-15-9-4-12(17(29-2)18(15)30-3)10-21-22-16(27)11-31-19-23-24-25-26(19)14-7-5-13(20)6-8-14/h4-10H,11H2,1-3H3,(H,22,27)/b21-10- |
| InChIKey | AUUKRMWTYMKBSJ-FBHDLOMBSA-N |
| XLogP | 2.58 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|