C20H15ClN6OS — CID 71588654
N-[(E)-(3-chlorophenyl)methylideneamino]-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide (PubChem CID 71588654) has the molecular formula C20H15ClN6OS and a molecular weight of 422.90 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 71588654 |
| Molecular Formula | C20H15ClN6OS |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc2ccccc12)N/N=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H15ClN6OS/c21-16-8-3-5-14(11-16)12-22-23-19(28)13-29-20-24-25-26-27(20)18-10-4-7-15-6-1-2-9-17(15)18/h1-12H,13H2,(H,23,28)/b22-12+ |
| InChIKey | KCBJFGKDUQWZRQ-WSDLNYQXSA-N |
| XLogP | 3.71 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|