C19H16N6O3S2 — CID 5275084
2-(1-naphthalen-1-yltetrazol-5-yl)sulfanyl-N-(2-sulfamoylphenyl)acetamide (PubChem CID 5275084) has the molecular formula C19H16N6O3S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 2-(1-naphthalen-1-yltetrazol-5-yl)sulfanyl-N-(2-sulfamoylphenyl)acetamide.
| Compound Name | 2-(1-naphthalen-1-yltetrazol-5-yl)sulfanyl-N-(2-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 5275084 |
| Molecular Formula | C19H16N6O3S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-(1-naphthalen-1-yltetrazol-5-yl)sulfanyl-N-(2-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccccc1NC(=O)CSc1nnnn1-c1cccc2ccccc12 |
| InChI | InChI=1S/C19H16N6O3S2/c20-30(27,28)17-11-4-3-9-15(17)21-18(26)12-29-19-22-23-24-25(19)16-10-5-7-13-6-1-2-8-14(13)16/h1-11H,12H2,(H,21,26)(H2,20,27,28) |
| InChIKey | FGARZUUYBUOFJQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |