C26H21N5OS — CID 1244330
N-benzhydryl-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide (PubChem CID 1244330) has the molecular formula C26H21N5OS and a molecular weight of 451.56 g/mol. Its IUPAC name is N-benzhydryl-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-benzhydryl-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1244330 |
| Molecular Formula | C26H21N5OS |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-benzhydryl-2-(1-naphthalen-1-yltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc2ccccc12)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21N5OS/c32-24(27-25(20-11-3-1-4-12-20)21-13-5-2-6-14-21)18-33-26-28-29-30-31(26)23-17-9-15-19-10-7-8-16-22(19)23/h1-17,25H,18H2,(H,27,32) |
| InChIKey | JFGUEFHEBFKTHK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |