C20H20N8O4S — CID 19577645
N-[(E)-(5-morpholin-4-yl-2-nitrophenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 19577645) has the molecular formula C20H20N8O4S and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[(E)-(5-morpholin-4-yl-2-nitrophenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(5-morpholin-4-yl-2-nitrophenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 19577645 |
| Molecular Formula | C20H20N8O4S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[(E)-(5-morpholin-4-yl-2-nitrophenyl)methylideneamino]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)N/N=C/c1cc(N2CCOCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N8O4S/c29-19(14-33-20-23-24-25-27(20)16-4-2-1-3-5-16)22-21-13-15-12-17(6-7-18(15)28(30)31)26-8-10-32-11-9-26/h1-7,12-13H,8-11,14H2,(H,22,29)/b21-13+ |
| InChIKey | RPIOOQPVKDWDNP-FYJGNVAPSA-N |
| XLogP | 1.65 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|