C12H16BrClN6O — CID 91962010
3-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 91962010) has the molecular formula C12H16BrClN6O and a molecular weight of 375.66 g/mol. Its IUPAC name is 3-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 91962010 |
| Molecular Formula | C12H16BrClN6O |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 3-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | CCc1nnc(NN=Cc2cc(Br)ccc2OC)n1N.Cl |
| InChI | InChI=1S/C12H15BrN6O.ClH/c1-3-11-16-18-12(19(11)14)17-15-7-8-6-9(13)4-5-10(8)20-2;/h4-7H,3,14H2,1-2H3,(H,17,18);1H |
| InChIKey | CZDUYJIFKMFNFI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|