C20H22BrN7O4S — CID 17075728
2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 17075728) has the molecular formula C20H22BrN7O4S and a molecular weight of 536.41 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17075728 |
| Molecular Formula | C20H22BrN7O4S |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(Br)cc1/C=N/Nc1nnc(SCC(=O)Nc2ccc(OC)c(OC)c2)n1N |
| InChI | InChI=1S/C20H22BrN7O4S/c1-30-15-6-4-13(21)8-12(15)10-23-25-19-26-27-20(28(19)22)33-11-18(29)24-14-5-7-16(31-2)17(9-14)32-3/h4-10H,11,22H2,1-3H3,(H,24,29)(H,25,26)/b23-10+ |
| InChIKey | TXVZXKYJRYGKAB-AUEPDCJTSA-N |
| XLogP | 2.96 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|