C20H22N8O4S — CID 17074739
N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17074739) has the molecular formula C20H22N8O4S and a molecular weight of 470.52 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17074739 |
| Molecular Formula | C20H22N8O4S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(/C=N/Nc2nnc(SCC(=O)Nc3cccc(NC(C)=O)c3)n2N)cc1O |
| InChI | InChI=1S/C20H22N8O4S/c1-12(29)23-14-4-3-5-15(9-14)24-18(31)11-33-20-27-26-19(28(20)21)25-22-10-13-6-7-17(32-2)16(30)8-13/h3-10,30H,11,21H2,1-2H3,(H,23,29)(H,24,31)(H,25,26)/b22-10+ |
| InChIKey | WYFHEZZWRNJCIR-LSHDLFTRSA-N |
| XLogP | 1.84 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|