C21H25N7O4S — CID 17048656
2-[[4-amino-5-[(2E)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethoxyphenyl)acetamide (PubChem CID 17048656) has the molecular formula C21H25N7O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 17048656 |
| Molecular Formula | C21H25N7O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nnc(N/N=C/c2ccc(OC)c(OC)c2)n1N |
| InChI | InChI=1S/C21H25N7O4S/c1-4-32-16-8-6-5-7-15(16)24-19(29)13-33-21-27-26-20(28(21)22)25-23-12-14-9-10-17(30-2)18(11-14)31-3/h5-12H,4,13,22H2,1-3H3,(H,24,29)(H,25,26)/b23-12+ |
| InChIKey | YYSCYUPNXVIGLC-FSJBWODESA-N |
| XLogP | 2.58 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|