C18H18ClN7O3S — CID 17074736
2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 17074736) has the molecular formula C18H18ClN7O3S and a molecular weight of 447.91 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 17074736 |
| Molecular Formula | C18H18ClN7O3S |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | COc1ccc(/C=N/Nc2nnc(SCC(=O)Nc3cccc(Cl)c3)n2N)cc1O |
| InChI | InChI=1S/C18H18ClN7O3S/c1-29-15-6-5-11(7-14(15)27)9-21-23-17-24-25-18(26(17)20)30-10-16(28)22-13-4-2-3-12(19)8-13/h2-9,27H,10,20H2,1H3,(H,22,28)(H,23,24)/b21-9+ |
| InChIKey | VVUTZCBBUXIZKD-ZVBGSRNCSA-N |
| XLogP | 2.54 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|