C18H17BrN8O4S — CID 17075706
2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 17075706) has the molecular formula C18H17BrN8O4S and a molecular weight of 521.36 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17075706 |
| Molecular Formula | C18H17BrN8O4S |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | COc1ccc(Br)cc1/C=N/Nc1nnc(SCC(=O)Nc2ccccc2[N+](=O)[O-])n1N |
| InChI | InChI=1S/C18H17BrN8O4S/c1-31-15-7-6-12(19)8-11(15)9-21-23-17-24-25-18(26(17)20)32-10-16(28)22-13-4-2-3-5-14(13)27(29)30/h2-9H,10,20H2,1H3,(H,22,28)(H,23,24)/b21-9+ |
| InChIKey | IJYZRJJOMBHZKG-ZVBGSRNCSA-N |
| XLogP | 2.85 |
| TPSA | 162.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|