C15H14N8O3S2 — CID 17074995
2-[[4-amino-5-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 17074995) has the molecular formula C15H14N8O3S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17074995 |
| Molecular Formula | C15H14N8O3S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2cccs2)nnc1SCC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14N8O3S2/c16-22-14(19-17-8-10-4-3-7-27-10)20-21-15(22)28-9-13(24)18-11-5-1-2-6-12(11)23(25)26/h1-8H,9,16H2,(H,18,24)(H,19,20)/b17-8+ |
| InChIKey | FVFWTKMOLOTWJD-CAOOACKPSA-N |
| XLogP | 2.14 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|