C17H15FN8O3S — CID 17048240
2-[[4-amino-5-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-fluorophenyl)acetamide (PubChem CID 17048240) has the molecular formula C17H15FN8O3S and a molecular weight of 430.43 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 17048240 |
| Molecular Formula | C17H15FN8O3S |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-fluorophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2ccc([N+](=O)[O-])cc2)nnc1SCC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C17H15FN8O3S/c18-12-2-1-3-13(8-12)21-15(27)10-30-17-24-23-16(25(17)19)22-20-9-11-4-6-14(7-5-11)26(28)29/h1-9H,10,19H2,(H,21,27)(H,22,23)/b20-9+ |
| InChIKey | IWMMLCRUBJAUKT-AWQFTUOYSA-N |
| XLogP | 2.22 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|