C17H15N9O5S — CID 17048209
2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 17048209) has the molecular formula C17H15N9O5S and a molecular weight of 457.43 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17048209 |
| Molecular Formula | C17H15N9O5S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2cccc([N+](=O)[O-])c2)nnc1SCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N9O5S/c18-24-16(21-19-9-11-2-1-3-14(8-11)26(30)31)22-23-17(24)32-10-15(27)20-12-4-6-13(7-5-12)25(28)29/h1-9H,10,18H2,(H,20,27)(H,21,22)/b19-9+ |
| InChIKey | IEAYCYGEIDLUIW-DJKKODMXSA-N |
| XLogP | 1.99 |
| TPSA | 196.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|