C16H16N8O3S2 — CID 17076769
2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 17076769) has the molecular formula C16H16N8O3S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17076769 |
| Molecular Formula | C16H16N8O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)n1N)c1cccs1 |
| InChI | InChI=1S/C16H16N8O3S2/c1-10(13-3-2-8-28-13)19-20-15-21-22-16(23(15)17)29-9-14(25)18-11-4-6-12(7-5-11)24(26)27/h2-8H,9,17H2,1H3,(H,18,25)(H,20,21)/b19-10+ |
| InChIKey | IOAWEXDBRIMDLS-VXLYETTFSA-N |
| XLogP | 2.53 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|