C17H19N7OS2 — CID 17076707
2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide (PubChem CID 17076707) has the molecular formula C17H19N7OS2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17076707 |
| Molecular Formula | C17H19N7OS2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide |
| SMILES | C/C(=N\Nc1nnc(SCC(=O)Nc2cccc(C)c2)n1N)c1cccs1 |
| InChI | InChI=1S/C17H19N7OS2/c1-11-5-3-6-13(9-11)19-15(25)10-27-17-23-22-16(24(17)18)21-20-12(2)14-7-4-8-26-14/h3-9H,10,18H2,1-2H3,(H,19,25)(H,21,22)/b20-12+ |
| InChIKey | OTFVAWRMGFMMOH-UDWIEESQSA-N |
| XLogP | 2.93 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|