C17H17N7O3S — CID 17048177
5-[(4-methoxyphenyl)methylsulfanyl]-3-N-[(E)-(3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 17048177) has the molecular formula C17H17N7O3S and a molecular weight of 399.44 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)methylsulfanyl]-3-N-[(E)-(3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(4-methoxyphenyl)methylsulfanyl]-3-N-[(E)-(3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 17048177 |
| Molecular Formula | C17H17N7O3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-[(4-methoxyphenyl)methylsulfanyl]-3-N-[(E)-(3-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | COc1ccc(CSc2nnc(N/N=C/c3cccc([N+](=O)[O-])c3)n2N)cc1 |
| InChI | InChI=1S/C17H17N7O3S/c1-27-15-7-5-12(6-8-15)11-28-17-22-21-16(23(17)18)20-19-10-13-3-2-4-14(9-13)24(25)26/h2-10H,11,18H2,1H3,(H,20,21)/b19-10+ |
| InChIKey | YNBSEVNFFLFKAO-VXLYETTFSA-N |
| XLogP | 2.65 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|