C18H14ClF3N8O3S — CID 17048190
2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 17048190) has the molecular formula C18H14ClF3N8O3S and a molecular weight of 514.88 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17048190 |
| Molecular Formula | C18H14ClF3N8O3S |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Nn1c(N/N=C/c2cccc([N+](=O)[O-])c2)nnc1SCC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14ClF3N8O3S/c19-14-5-4-11(7-13(14)18(20,21)22)25-15(31)9-34-17-28-27-16(29(17)23)26-24-8-10-2-1-3-12(6-10)30(32)33/h1-8H,9,23H2,(H,25,31)(H,26,27)/b24-8+ |
| InChIKey | RDJAXMLXADZJJD-KTZMUZOWSA-N |
| XLogP | 3.75 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|