C14H18ClN6O3- — CID 53352448
[4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate chloride (PubChem CID 53352448) has the molecular formula C14H18ClN6O3- and a molecular weight of 353.79 g/mol. Its IUPAC name is [4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate chloride.
| Compound Name | [4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate chloride |
|---|---|
| PubChem CID | 53352448 |
| Molecular Formula | C14H18ClN6O3- |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate chloride |
| SMILES | CCc1nnc(NN=Cc2ccc(OC(C)=O)c(OC)c2)n1N.[Cl-] |
| InChI | InChI=1S/C14H18N6O3.ClH/c1-4-13-17-19-14(20(13)15)18-16-8-10-5-6-11(23-9(2)21)12(7-10)22-3;/h5-8H,4,15H2,1-3H3,(H,18,19);1H/p-1 |
| InChIKey | HOILMFNEAIRWDW-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|