C11H14N6O6S2 — CID 98004951
4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid (PubChem CID 98004951) has the molecular formula C11H14N6O6S2 and a molecular weight of 390.40 g/mol. Its IUPAC name is 4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 98004951 |
| Molecular Formula | C11H14N6O6S2 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 4-[(Z)-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]benzene-1,3-disulfonic acid |
| SMILES | CCc1nnc(N/N=C\c2ccc(S(=O)(=O)O)cc2S(=O)(=O)O)n1N |
| InChI | InChI=1S/C11H14N6O6S2/c1-2-10-14-16-11(17(10)12)15-13-6-7-3-4-8(24(18,19)20)5-9(7)25(21,22)23/h3-6H,2,12H2,1H3,(H,15,16)(H,18,19,20)(H,21,22,23)/b13-6- |
| InChIKey | KWIDRZBIJZPILV-MLPAPPSSSA-N |
| XLogP | -0.51 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|