C15H14ClN7O3 — CID 3098686
3-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine (PubChem CID 3098686) has the molecular formula C15H14ClN7O3 and a molecular weight of 375.78 g/mol. Its IUPAC name is 3-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 3098686 |
| Molecular Formula | C15H14ClN7O3 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 3-N-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-5-ethyl-1,2,4-triazole-3,4-diamine |
| SMILES | CCc1nnc(NN=Cc2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)n1N |
| InChI | InChI=1S/C15H14ClN7O3/c1-2-14-19-21-15(22(14)17)20-18-8-10-4-6-13(26-10)11-5-3-9(23(24)25)7-12(11)16/h3-8H,2,17H2,1H3,(H,20,21) |
| InChIKey | OWKKOOYNMVSHNE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|