C10H12N4S2 — CID 110521876
(Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-thiophen-2-ylmethanimine (PubChem CID 110521876) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is (Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-thiophen-2-ylmethanimine.
| Compound Name | (Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-thiophen-2-ylmethanimine |
|---|---|
| PubChem CID | 110521876 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | (Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-thiophen-2-ylmethanimine |
| SMILES | CCc1nnc(SC)n1/N=C\c1cccs1 |
| InChI | InChI=1S/C10H12N4S2/c1-3-9-12-13-10(15-2)14(9)11-7-8-5-4-6-16-8/h4-7H,3H2,1-2H3/b11-7- |
| InChIKey | ORNIBZNVWKKZET-XFFZJAGNSA-N |
| XLogP | 2.51 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|