C10H12N4OS — CID 110521878
(Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine (PubChem CID 110521878) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is (Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine.
| Compound Name | (Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine |
|---|---|
| PubChem CID | 110521878 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (Z)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(furan-2-yl)methanimine |
| SMILES | CCc1nnc(SC)n1/N=C\c1ccco1 |
| InChI | InChI=1S/C10H12N4OS/c1-3-9-12-13-10(16-2)14(9)11-7-8-5-4-6-15-8/h4-7H,3H2,1-2H3/b11-7- |
| InChIKey | ZMMIRLOOWSNYMV-XFFZJAGNSA-N |
| XLogP | 2.04 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|