C16H16N4OS — CID 110522142
(Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(5-methylfuran-2-yl)methanimine (PubChem CID 110522142) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(5-methylfuran-2-yl)methanimine.
| Compound Name | (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(5-methylfuran-2-yl)methanimine |
|---|---|
| PubChem CID | 110522142 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(5-methylfuran-2-yl)methanimine |
| SMILES | CSc1nnc(Cc2ccccc2)n1/N=C\c1ccc(C)o1 |
| InChI | InChI=1S/C16H16N4OS/c1-12-8-9-14(21-12)11-17-20-15(18-19-16(20)22-2)10-13-6-4-3-5-7-13/h3-9,11H,10H2,1-2H3/b17-11- |
| InChIKey | ANSRIFVHCRPAKB-BOPFTXTBSA-N |
| XLogP | 3.37 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|