C21H21N5S — CID 110522262
(Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(1,2-dimethylindol-3-yl)methanimine (PubChem CID 110522262) has the molecular formula C21H21N5S and a molecular weight of 375.50 g/mol. Its IUPAC name is (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(1,2-dimethylindol-3-yl)methanimine.
| Compound Name | (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(1,2-dimethylindol-3-yl)methanimine |
|---|---|
| PubChem CID | 110522262 |
| Molecular Formula | C21H21N5S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(1,2-dimethylindol-3-yl)methanimine |
| SMILES | CSc1nnc(Cc2ccccc2)n1/N=C\c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C21H21N5S/c1-15-18(17-11-7-8-12-19(17)25(15)2)14-22-26-20(23-24-21(26)27-3)13-16-9-5-4-6-10-16/h4-12,14H,13H2,1-3H3/b22-14- |
| InChIKey | QSZOVZBWFOQERJ-HMAPJEAMSA-N |
| XLogP | 4.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|