C21H21N5S — CID 110520253
3-benzyl-4-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 110520253) has the molecular formula C21H21N5S and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-benzyl-4-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-benzyl-4-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520253 |
| Molecular Formula | C21H21N5S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-benzyl-4-[(Z)-(1-ethyl-2-methylindol-3-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCn1c(C)c(/C=N\n2c(Cc3ccccc3)n[nH]c2=S)c2ccccc21 |
| InChI | InChI=1S/C21H21N5S/c1-3-25-15(2)18(17-11-7-8-12-19(17)25)14-22-26-20(23-24-21(26)27)13-16-9-5-4-6-10-16/h4-12,14H,3,13H2,1-2H3,(H,24,27)/b22-14- |
| InChIKey | ONAZBHBQYRJLTO-HMAPJEAMSA-N |
| XLogP | 4.70 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|