C19H17N5S — CID 110520382
4-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 110520382) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is 4-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110520382 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[(Z)-(1,2-dimethylindol-3-yl)methylideneamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1c(/C=N\n2c(-c3ccccc3)n[nH]c2=S)c2ccccc2n1C |
| InChI | InChI=1S/C19H17N5S/c1-13-16(15-10-6-7-11-17(15)23(13)2)12-20-24-18(21-22-19(24)25)14-8-4-3-5-9-14/h3-12H,1-2H3,(H,22,25)/b20-12- |
| InChIKey | RQPNVXMUMPAQAH-NDENLUEZSA-N |
| XLogP | 4.29 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|