C15H11BrN4 — CID 9027901
(Z)-1-(2-bromophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9027901) has the molecular formula C15H11BrN4 and a molecular weight of 327.19 g/mol. Its IUPAC name is (Z)-1-(2-bromophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(2-bromophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9027901 |
| Molecular Formula | C15H11BrN4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | (Z)-1-(2-bromophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | Brc1ccccc1/C=N\n1cnnc1-c1ccccc1 |
| InChI | InChI=1S/C15H11BrN4/c16-14-9-5-4-8-13(14)10-18-20-11-17-19-15(20)12-6-2-1-3-7-12/h1-11H/b18-10- |
| InChIKey | NFPCPOSTWFRLND-ZDLGFXPLSA-N |
| XLogP | 3.59 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|