C20H17ClN6 — CID 9028217
(Z)-1-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9028217) has the molecular formula C20H17ClN6 and a molecular weight of 376.85 g/mol. Its IUPAC name is (Z)-1-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9028217 |
| Molecular Formula | C20H17ClN6 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (Z)-1-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=N\n1cnnc1-c1ccccc1 |
| InChI | InChI=1S/C20H17ClN6/c1-15-18(19(21)26(25-15)13-16-8-4-2-5-9-16)12-23-27-14-22-24-20(27)17-10-6-3-7-11-17/h2-12,14H,13H2,1H3/b23-12- |
| InChIKey | ZZMKAKPPIXAZJY-FMCGGJTJSA-N |
| XLogP | 4.03 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|