C18H13Cl4N5O2 — CID 25379440
4-[(2Z)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid (PubChem CID 25379440) has the molecular formula C18H13Cl4N5O2 and a molecular weight of 473.15 g/mol. Its IUPAC name is 4-[(2Z)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid.
| Compound Name | 4-[(2Z)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 25379440 |
| Molecular Formula | C18H13Cl4N5O2 |
| Molecular Weight | 473.15 g/mol |
| Exact Mass | 470.98 |
| IUPAC Name | 4-[(2Z)-2-[(1-benzyl-5-chloro-3-methylpyrazol-4-yl)methylidene]hydrazinyl]-3,5,6-trichloropyridine-2-carboxylic acid |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=N\Nc1c(Cl)c(Cl)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C18H13Cl4N5O2/c1-9-11(17(22)27(26-9)8-10-5-3-2-4-6-10)7-23-25-14-12(19)15(18(28)29)24-16(21)13(14)20/h2-7H,8H2,1H3,(H,24,25)(H,28,29)/b23-7- |
| InChIKey | RLYRIEUKAAYULT-FINSYCMTSA-N |
| XLogP | 5.39 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.15 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|