C15H15F2N3O3 — CID 23376478
6-amino-1-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-4-methylpyridin-2-one (PubChem CID 23376478) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is 6-amino-1-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 23376478 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 6-amino-1-[[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]-4-methylpyridin-2-one |
| SMILES | COc1cc(C=Nn2c(N)cc(C)cc2=O)ccc1OC(F)F |
| InChI | InChI=1S/C15H15F2N3O3/c1-9-5-13(18)20(14(21)6-9)19-8-10-3-4-11(23-15(16)17)12(7-10)22-2/h3-8,15H,18H2,1-2H3 |
| InChIKey | NCVIBBKSXWYQPU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|