C16H19N3O3 — CID 9024571
6-amino-1-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one (PubChem CID 9024571) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 6-amino-1-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 9024571 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 6-amino-1-[(Z)-(3-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
| SMILES | CCOc1cc(/C=N\n2c(N)cc(C)cc2=O)ccc1OC |
| InChI | InChI=1S/C16H19N3O3/c1-4-22-14-9-12(5-6-13(14)21-3)10-18-19-15(17)7-11(2)8-16(19)20/h5-10H,4,17H2,1-3H3/b18-10- |
| InChIKey | ILLUJDCSOJTRIA-ZDLGFXPLSA-N |
| XLogP | 2.03 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|