C16H18BrN3O3 — CID 9024559
6-amino-1-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one (PubChem CID 9024559) has the molecular formula C16H18BrN3O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is 6-amino-1-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 9024559 |
| Molecular Formula | C16H18BrN3O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 6-amino-1-[(Z)-(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
| SMILES | CCOc1cc(/C=N\n2c(N)cc(C)cc2=O)cc(Br)c1OC |
| InChI | InChI=1S/C16H18BrN3O3/c1-4-23-13-8-11(7-12(17)16(13)22-3)9-19-20-14(18)5-10(2)6-15(20)21/h5-9H,4,18H2,1-3H3/b19-9- |
| InChIKey | YSHCHCHUOIPNTP-OCKHKDLRSA-N |
| XLogP | 2.79 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|