C19H17N3O5 — CID 9024509
[4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 9024509) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is [4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 9024509 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(/C=N\n2c(N)cc(C)cc2=O)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C19H17N3O5/c1-12-8-17(20)22(18(23)9-12)21-11-13-5-6-14(16(10-13)25-2)27-19(24)15-4-3-7-26-15/h3-11H,20H2,1-2H3/b21-11- |
| InChIKey | FCQBJVPOBJZNTD-NHDPSOOVSA-N |
| XLogP | 2.44 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|