C22H18N4O4S — CID 4856528
[2-methoxy-4-[[3-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 4856528) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is [2-methoxy-4-[[3-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[[3-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 4856528 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [2-methoxy-4-[[3-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3C)n[nH]c2=S)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C22H18N4O4S/c1-14-6-3-4-7-16(14)20-24-25-22(31)26(20)23-13-15-9-10-17(19(12-15)28-2)30-21(27)18-8-5-11-29-18/h3-13H,1-2H3,(H,25,31) |
| InChIKey | ZHUJAQPJQKKLEQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|